CAS 324776-77-4 is the registry number for 1,4-Bis[(3-Iodophenyl)carbonyl]piperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
[4-(3-iodobenzoyl)piperazin-1-yl]-(3-iodophenyl)methanone (CAS 324776-77-4) is a chemical compound with the molecular formula C18H16I2N2O2 and a molecular weight of 546.1 g/mol. IUPAC name: [4-(3-iodobenzoyl)piperazin-1-yl]-(3-iodophenyl)methanone. InChIKey: OKBFMRUDRLALFB-UHFFFAOYSA-N.
| Molecular formula | C18H16I2N2O2 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | [4-(3-iodobenzoyl)piperazin-1-yl]-(3-iodophenyl)methanone |
| InChIKey | OKBFMRUDRLALFB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC(=CC=C2)I)C(=O)C3=CC(=CC=C3)I |
Computed by PubChem (NCBI)