CAS 324777-59-5 is the registry number for 1-(2-naphthylsulfonyl)-4-phenylpiperazine. Offered by: Biosynth. Available pack sizes: 250mg.
1-naphthalen-2-ylsulfonyl-4-phenylpiperazine (CAS 324777-59-5) is a chemical compound with the molecular formula C20H20N2O2S and a molecular weight of 352.5 g/mol. IUPAC name: 1-naphthalen-2-ylsulfonyl-4-phenylpiperazine. InChIKey: RKVDGVRGABKUCO-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O2S |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 1-naphthalen-2-ylsulfonyl-4-phenylpiperazine |
| InChIKey | RKVDGVRGABKUCO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)