CAS 32485-99-7 is the registry number for 4′-Phosphopantetheine disodium. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.
CAS 32485-99-7 identifies a chemical compound with the molecular formula C11H23N2NaO7PS and a molecular weight of 381.34 g/mol. InChIKey: CGQGEONIBXGEGJ-FVGYRXGTSA-N.
| Molecular formula | C11H23N2NaO7PS |
|---|---|
| Molecular weight | 381.34 g/mol |
| InChIKey | CGQGEONIBXGEGJ-FVGYRXGTSA-N |
| SMILES | CC(C)(COP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCS)O.[Na] |
Computed by PubChem (NCBI)