CAS 3249-92-1 appears in our catalog under these names: Barium inosinate hydrate, 95%, 5'–Inosinic acid barium salt. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg.
Barium(2+);[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate (CAS 3249-92-1) is a chemical compound with the molecular formula C10H11BaN4O8P and a molecular weight of 483.52 g/mol. IUPAC name: barium(2+);[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate. InChIKey: XRBNGVUPCIBZIL-MCDZGGTQSA-L.
| Molecular formula | C10H11BaN4O8P |
|---|---|
| Molecular weight | 483.52 g/mol |
| IUPAC name | barium(2+);[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate |
| InChIKey | XRBNGVUPCIBZIL-MCDZGGTQSA-L |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O.[Ba+2] |
Computed by PubChem (NCBI)