CAS 325-04-2 appears in our catalog under these names: 4-phenylbenzenesulfonyl fluoride, 95%, [1,1'-BIPHENYL]-4-SULFONYL FLUORIDE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
4-phenylbenzenesulfonyl fluoride (CAS 325-04-2) is a chemical compound with the molecular formula C12H9FO2S and a molecular weight of 236.26 g/mol. IUPAC name: 4-phenylbenzenesulfonyl fluoride. InChIKey: PNFCPDDYELHQKF-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2S |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-phenylbenzenesulfonyl fluoride |
| InChIKey | PNFCPDDYELHQKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)F |
Computed by PubChem (NCBI)