CAS 325144-72-7 is the registry number for (R)-3-Hydroxy-3-methyl-5-oxo-5-(((2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-((2-methyl-4-oxo-4H-pyran-3-yl)oxy)tetrahydro-2H-pyran-2-yl)methoxy)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Licoagroside B is a monosaccharide derivative resulting from the formal condensation of the hydroxy group of 2-methyl-4-oxo-4H-pyran-3-yl beta-D-glucopyranoside with the carboxy group of 3-hydroxy-3-methylglutaric acid. It has a role as a plant metabolite. It is a beta-D-glucoside, a tertiary alcohol, a dicarboxylic acid monoester and a monosaccharide derivative. It is functionally related to a beta-D-glucose, a 3-hydroxy-3-methylglutaric acid and a 3-hydroxy-2-methyl-4-pyrone.
Source: ChEBI
| Molecular formula | C18H24O12 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | 3-hydroxy-3-methyl-5-oxo-5-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methyl-4-oxopyran-3-yl)oxyoxan-2-yl]methoxy]pentanoic acid |
| InChIKey | WCVUIHQUPRXYKT-RGCIIANRSA-N |
| SMILES | CC1=C(C(=O)C=CO1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)CC(C)(CC(=O)O)O)O)O)O |
Computed by PubChem (NCBI)