CAS 325168-07-8 is the registry number for 1-(4-Aminophenyl)-3,3-dimethylazetidin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-aminophenyl)-3,3-dimethylazetidin-2-one (CAS 325168-07-8) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 1-(4-aminophenyl)-3,3-dimethylazetidin-2-one. InChIKey: JAVORSDDGKMCPH-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-(4-aminophenyl)-3,3-dimethylazetidin-2-one |
| InChIKey | JAVORSDDGKMCPH-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1=O)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)