CAS 32523-77-6 is the registry number for rel-((1S,2R)-2-Bromocyclopropyl)benzene, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[(1S,2R)-2-bromocyclopropyl]benzene (CAS 32523-77-6) is a chemical compound with the molecular formula C9H9Br and a molecular weight of 197.07 g/mol. IUPAC name: [(1S,2R)-2-bromocyclopropyl]benzene. InChIKey: IITYLOQJUHFLPM-DTWKUNHWSA-N.
| Molecular formula | C9H9Br |
|---|---|
| Molecular weight | 197.07 g/mol |
| IUPAC name | [(1S,2R)-2-bromocyclopropyl]benzene |
| InChIKey | IITYLOQJUHFLPM-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)