CAS 325475-79-4 is the registry number for 3-(2-(2,4-dichlorophenoxy)acetylhydrazidyl)-2-oxoindoline. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,4-dichlorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (CAS 325475-79-4) is a chemical compound with the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.2 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide. InChIKey: IPYZIYVCXJTAPW-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2N3O3 |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| InChIKey | IPYZIYVCXJTAPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=NC(=O)COC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)