CAS 325741-22-8 is the registry number for (3,5-dinitrophenyl)-N-(2-chloro-5-(trifluoromethyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-chloro-5-(trifluoromethyl)phenyl]-3,5-dinitrobenzamide (CAS 325741-22-8) is a chemical compound with the molecular formula C14H7ClF3N3O5 and a molecular weight of 389.67 g/mol. IUPAC name: N-[2-chloro-5-(trifluoromethyl)phenyl]-3,5-dinitrobenzamide. InChIKey: LRCWBLBDCLMVJN-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF3N3O5 |
|---|---|
| Molecular weight | 389.67 g/mol |
| IUPAC name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3,5-dinitrobenzamide |
| InChIKey | LRCWBLBDCLMVJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NC(=O)C2=CC(=CC(=C2)[N+](=O)[O-])[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)