CAS 325786-25-2 appears in our catalog under these names: 4-Chloro-2-fluoro-5-ethoxycarbonylphenylboronic acid, 4-Chloro-2-fluoro-5-ethoxycarbonylphenylboronic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 500mg, 5g, 10g, 1g, 250mg.
(4-chloro-5-ethoxycarbonyl-2-fluorophenyl)boronic acid (CAS 325786-25-2) is a chemical compound with the molecular formula C9H9BClFO4 and a molecular weight of 246.43 g/mol. IUPAC name: (4-chloro-5-ethoxycarbonyl-2-fluorophenyl)boronic acid. InChIKey: AFUHWELFZBBIMI-UHFFFAOYSA-N.
| Molecular formula | C9H9BClFO4 |
|---|---|
| Molecular weight | 246.43 g/mol |
| IUPAC name | (4-chloro-5-ethoxycarbonyl-2-fluorophenyl)boronic acid |
| InChIKey | AFUHWELFZBBIMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Cl)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)