CAS 32580-26-0 is the registry number for 2-(2-Bromo-acetylamino)-5-chloro-benzophenone. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2,5g, 250mg, 0,025g, 0,05g, 0,1g, 0,25g, 0,5g.
N-(2-benzoyl-4-chlorophenyl)-2-bromoacetamide (CAS 32580-26-0) is a chemical compound with the molecular formula C15H11BrClNO2 and a molecular weight of 352.61 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2-bromoacetamide. InChIKey: VYYHFSBVBDFTML-UHFFFAOYSA-N.
| Molecular formula | C15H11BrClNO2 |
|---|---|
| Molecular weight | 352.61 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-2-bromoacetamide |
| InChIKey | VYYHFSBVBDFTML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CBr |
Computed by PubChem (NCBI)