CAS 32588-53-7 appears in our catalog under these names: 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt, 95%, 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 1000g, 500g.
Disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate (CAS 32588-53-7) is a chemical compound with the molecular formula C10H5NNa2O8S2 and a molecular weight of 377.3 g/mol. IUPAC name: disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate. InChIKey: DMKMTGULLYISBH-UHFFFAOYSA-L.
| Molecular formula | C10H5NNa2O8S2 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate |
| InChIKey | DMKMTGULLYISBH-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C(=C(C=C2C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O)N=O.[Na+].[Na+] |
Computed by PubChem (NCBI)