CAS 325970-71-6 appears in our catalog under these names: L 67, L67/ 99.79% (existing batch purity), L67, L67 98+%, L67, ≥95%, ≥95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 200mg, 5mg, 250mg, 100 mg.
2-(3,5-dibromo-4-methylanilino)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (CAS 325970-71-6) is a chemical compound with the molecular formula C16H14Br2N4O4 and a molecular weight of 486.1 g/mol. IUPAC name: 2-(3,5-dibromo-4-methylanilino)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide. InChIKey: KFEPVFJQVOMODD-IFRROFPPSA-N.
| Molecular formula | C16H14Br2N4O4 |
|---|---|
| Molecular weight | 486.1 g/mol |
| IUPAC name | 2-(3,5-dibromo-4-methylanilino)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| InChIKey | KFEPVFJQVOMODD-IFRROFPPSA-N |
| SMILES | CC1=C(C=C(C=C1Br)NCC(=O)N/N=C/C2=C(C=CC(=C2)[N+](=O)[O-])O)Br |
Computed by PubChem (NCBI)