CAS 325988-82-7 is the registry number for 4-(2,5-Dichloro-3-thienyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-amine (CAS 325988-82-7) is a chemical compound with the molecular formula C7H4Cl2N2S2 and a molecular weight of 251.2 g/mol. IUPAC name: 4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-amine. InChIKey: ZQLZXFNAKNVLPB-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S2 |
|---|---|
| Molecular weight | 251.2 g/mol |
| IUPAC name | 4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-amine |
| InChIKey | ZQLZXFNAKNVLPB-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C2=CSC(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)