CAS 325991-26-2 is the registry number for 2-(Adamantan-1-yl)butan-2-yl methacrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate (CAS 325991-26-2) is a chemical compound with the molecular formula C18H28O2 and a molecular weight of 276.4 g/mol. IUPAC name: 2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate. InChIKey: VETHGFSIJSVUSX-UHFFFAOYSA-N.
| Molecular formula | C18H28O2 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate |
| InChIKey | VETHGFSIJSVUSX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C12CC3CC(C1)CC(C3)C2)OC(=O)C(=C)C |
Computed by PubChem (NCBI)