Products 325991-26-2

CAS 325991-26-2 is the registry number for 2-(Adamantan-1-yl)butan-2-yl methacrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate (CAS 325991-26-2) is a chemical compound with the molecular formula C18H28O2 and a molecular weight of 276.4 g/mol. IUPAC name: 2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate. InChIKey: VETHGFSIJSVUSX-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O2
Molecular weight276.4 g/mol
IUPAC name2-(1-adamantyl)butan-2-yl 2-methylprop-2-enoate
InChIKeyVETHGFSIJSVUSX-UHFFFAOYSA-N
SMILESCCC(C)(C12CC3CC(C1)CC(C3)C2)OC(=O)C(=C)C

Computed by PubChem (NCBI)