Products 325996-24-5
CAS 325996-24-5 is the registry number for 8-((2-(4-methoxyphenyl)-2-oxoethyl)thio)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
8-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione (CAS 325996-24-5) is a chemical compound with the molecular formula C16H16N4O4S and a molecular weight of 360.4 g/mol. IUPAC name: 8-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: AITPQUGTTQPTRB-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 8-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | AITPQUGTTQPTRB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)SCC(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)