Products 326023-02-3
CAS 326023-02-3 appears in our catalog under these names: 3-Amino-N-(4-chlorophenyl)-4-(piperidin-1-yl)benzene-1-sulfonamide, 95%, 3-Amino-N-(4-chlorophenyl)-4-(piperidin-1-yl)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-amino-N-(4-chlorophenyl)-4-piperidin-1-ylbenzenesulfonamide (CAS 326023-02-3) is a chemical compound with the molecular formula C17H20ClN3O2S and a molecular weight of 365.9 g/mol. IUPAC name: 3-amino-N-(4-chlorophenyl)-4-piperidin-1-ylbenzenesulfonamide. InChIKey: INCDAIWATSOPRP-UHFFFAOYSA-N.
| Molecular formula | C17H20ClN3O2S |
|---|---|
| Molecular weight | 365.9 g/mol |
| IUPAC name | 3-amino-N-(4-chlorophenyl)-4-piperidin-1-ylbenzenesulfonamide |
| InChIKey | INCDAIWATSOPRP-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)S(=O)(=O)NC3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)