CAS 326097-91-0 appears in our catalog under these names: 3-Amino-5-(4-fluoro-phenyl)-3h-thieno[2,3-d]pyrimidin-4-one, 95%, 3-Amino-5-(4-fluorophenyl)-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-one (CAS 326097-91-0) is a chemical compound with the molecular formula C12H8FN3OS and a molecular weight of 261.28 g/mol. IUPAC name: 3-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-one. InChIKey: NJWGPDNPKTVSTG-UHFFFAOYSA-N.
| Molecular formula | C12H8FN3OS |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | 3-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-one |
| InChIKey | NJWGPDNPKTVSTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=O)N(C=N3)N)F |
Computed by PubChem (NCBI)