Products 326102-48-1

CAS 326102-48-1 is the registry number for [(6-Chloro-4-methyl-2-oxo-2h-chromen-7-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid (CAS 326102-48-1) is a chemical compound with the molecular formula C12H9ClO5 and a molecular weight of 268.65 g/mol. IUPAC name: 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid. InChIKey: ZWRVNXQUKBLRAT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO5
Molecular weight268.65 g/mol
IUPAC name2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid
InChIKeyZWRVNXQUKBLRAT-UHFFFAOYSA-N
SMILESCC1=CC(=O)OC2=CC(=C(C=C12)Cl)OCC(=O)O

Computed by PubChem (NCBI)