CAS 326495-24-3 appears in our catalog under these names: 1–Oleoyl–2–hydroxy–sn–glycero–3–PG (sodium salt), 18:1 LYSO PG, 1-Oleoyl-2-hydroxy-sn-glycero-3-PG (sodium salt), 98%, 98%, 1-Oleoyl-2-hydroxy-sn-glycero-3-PG (sodium), 99.0%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 500MG, 100mg, 5 mg, 10 mg, 1 mg.
Sodium 2,3-dihydroxypropyl [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] phosphate (CAS 326495-24-3) is a chemical compound with the molecular formula C24H46NaO9P and a molecular weight of 532.6 g/mol. IUPAC name: sodium 2,3-dihydroxypropyl [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] phosphate. InChIKey: STLDIXSFXILIFT-AXFOVFEGSA-M.
| Molecular formula | C24H46NaO9P |
|---|---|
| Molecular weight | 532.6 g/mol |
| IUPAC name | sodium 2,3-dihydroxypropyl [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] phosphate |
| InChIKey | STLDIXSFXILIFT-AXFOVFEGSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC(CO)O)O.[Na+] |
Computed by PubChem (NCBI)