CAS 326496-01-9 is the registry number for (5-Bromopyridin-2-yl)(2-(tert-butyldimethylsilyloxy)ethyl)methylamine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
5-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methylpyridin-2-amine (CAS 326496-01-9) is a chemical compound with the molecular formula C14H25BrN2OSi and a molecular weight of 345.35 g/mol. IUPAC name: 5-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methylpyridin-2-amine. InChIKey: WVTIXZIWALRKBZ-UHFFFAOYSA-N.
| Molecular formula | C14H25BrN2OSi |
|---|---|
| Molecular weight | 345.35 g/mol |
| IUPAC name | 5-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methylpyridin-2-amine |
| InChIKey | WVTIXZIWALRKBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(C)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)