Products 32659-29-3
CAS 32659-29-3 is the registry number for Cytarabine Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
4-(chloromethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol (CAS 32659-29-3) is a chemical compound with the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. IUPAC name: 4-(chloromethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol. InChIKey: KSCUAPCTLRFVPI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O3 |
|---|---|
| Molecular weight | 243.65 g/mol |
| IUPAC name | 4-(chloromethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol |
| InChIKey | KSCUAPCTLRFVPI-UHFFFAOYSA-N |
| SMILES | C1=CN2C3C(C(C(O3)CCl)O)OC2=NC1=N |
Computed by PubChem (NCBI)