CAS 874754-20-8 appears in our catalog under these names: 6-Amino-5-(chloroacetyl)-1-cyclopropylpyrimidine-2,4(1h,3h)-dione, 95%, 6-Amino-5-(2-chloroacetyl)-1-cyclopropylpyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6-amino-5-(2-chloroacetyl)-1-cyclopropylpyrimidine-2,4-dione (CAS 874754-20-8) is a chemical compound with the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. IUPAC name: 6-amino-5-(2-chloroacetyl)-1-cyclopropylpyrimidine-2,4-dione. InChIKey: LROVKHYXVSYZMC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O3 |
|---|---|
| Molecular weight | 243.65 g/mol |
| IUPAC name | 6-amino-5-(2-chloroacetyl)-1-cyclopropylpyrimidine-2,4-dione |
| InChIKey | LROVKHYXVSYZMC-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=C(C(=O)NC2=O)C(=O)CCl)N |
Computed by PubChem (NCBI)