Products 326602-11-3

CAS 326602-11-3 is the registry number for Propan-1-amine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-1-amine;2,2,2-trifluoroacetic acid (CAS 326602-11-3) is a chemical compound with the molecular formula C5H10F3NO2 and a molecular weight of 173.13 g/mol. IUPAC name: propan-1-amine;2,2,2-trifluoroacetic acid. InChIKey: QSQHZXBTJCXIAV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10F3NO2
Molecular weight173.13 g/mol
IUPAC namepropan-1-amine;2,2,2-trifluoroacetic acid
InChIKeyQSQHZXBTJCXIAV-UHFFFAOYSA-N
SMILESCCCN.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)