Products 32676-16-7

CAS 32676-16-7 is the registry number for 1,2-Dihydroperillic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

4-prop-1-en-2-ylcyclohexane-1-carboxylic acid (CAS 32676-16-7) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: 4-prop-1-en-2-ylcyclohexane-1-carboxylic acid. InChIKey: XZOBEDLKVOHSSH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O2
Molecular weight168.23 g/mol
IUPAC name4-prop-1-en-2-ylcyclohexane-1-carboxylic acid
InChIKeyXZOBEDLKVOHSSH-UHFFFAOYSA-N
SMILESCC(=C)C1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)