CAS 326811-97-6 is the registry number for (2R,4S)-4-Methylpyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-4-methylpyrrolidine-2-carboxylic acid (CAS 326811-97-6) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: (2R,4S)-4-methylpyrrolidine-2-carboxylic acid. InChIKey: KKJQZEWNZXRJFG-CRCLSJGQSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | (2R,4S)-4-methylpyrrolidine-2-carboxylic acid |
| InChIKey | KKJQZEWNZXRJFG-CRCLSJGQSA-N |
| SMILES | C[C@H]1C[C@@H](NC1)C(=O)O |
Computed by PubChem (NCBI)