CAS 326879-87-2 is the registry number for Methyl 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoate (CAS 326879-87-2) is a chemical compound with the molecular formula C18H17NO3S and a molecular weight of 327.4 g/mol. IUPAC name: methyl 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoate. InChIKey: LCGQEERJQFLNLJ-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | methyl 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoate |
| InChIKey | LCGQEERJQFLNLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2N(C(=O)CS2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)