CAS 326900-82-7 is the registry number for 1H-Indole-3-carboxaldehyde 1H-Benzimidazol-2-ylhydrazone. Offered by: TRC. Available pack sizes: 500mg.
N-[(E)-1H-indol-3-ylmethylideneamino]-1H-benzimidazol-2-amine (CAS 326900-82-7) is a chemical compound with the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. IUPAC name: N-[(E)-1H-indol-3-ylmethylideneamino]-1H-benzimidazol-2-amine. InChIKey: QKWVMNHEYIXJMJ-VCHYOVAHSA-N.
| Molecular formula | C16H13N5 |
|---|---|
| Molecular weight | 275.31 g/mol |
| IUPAC name | N-[(E)-1H-indol-3-ylmethylideneamino]-1H-benzimidazol-2-amine |
| InChIKey | QKWVMNHEYIXJMJ-VCHYOVAHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=N/NC3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)