CAS 327-92-4 appears in our catalog under these names: 1,5-Difluoro-2,4-dinitrobenzene, 98%, 1,5-Difluoro-2,4-dinitrobenzene, >95% (HPLC), 1,5–Difluoro–2,4–dinitrobenzene, 1,5-Difluoro-2,4-dinitrobenzene, 1,5-Difluoro-2,4-dinitrobenzene, >97.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 10g, 1g, 25g, 100g, 500g, 2g, 5g.
1,5-difluoro-2,4-dinitrobenzene (CAS 327-92-4) is a chemical compound with the molecular formula C6H2F2N2O4 and a molecular weight of 204.09 g/mol. IUPAC name: 1,5-difluoro-2,4-dinitrobenzene. InChIKey: VILFTWLXLYIEMV-UHFFFAOYSA-N.
| Molecular formula | C6H2F2N2O4 |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 1,5-difluoro-2,4-dinitrobenzene |
| InChIKey | VILFTWLXLYIEMV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)