Products 327-94-6

CAS 327-94-6 appears in our catalog under these names: 4-Fluorobenzene-1,3-dioyl dichloride, 97%, 4-Fluoroisophthaloyl dichloride, 95%, 4-Fluorobenzene-1,3-dioyl dichloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 2000mg.

Structural formula: {0} (CAS {1})

4-fluorobenzene-1,3-dicarbonyl chloride (CAS 327-94-6) is a chemical compound with the molecular formula C8H3Cl2FO2 and a molecular weight of 221.01 g/mol. IUPAC name: 4-fluorobenzene-1,3-dicarbonyl chloride. InChIKey: FZQOFIVDXNZKTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2FO2
Molecular weight221.01 g/mol
IUPAC name4-fluorobenzene-1,3-dicarbonyl chloride
InChIKeyFZQOFIVDXNZKTJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)Cl)C(=O)Cl)F

Computed by PubChem (NCBI)