CAS 327-94-6 appears in our catalog under these names: 4-Fluorobenzene-1,3-dioyl dichloride, 97%, 4-Fluoroisophthaloyl dichloride, 95%, 4-Fluorobenzene-1,3-dioyl dichloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 2000mg.
4-fluorobenzene-1,3-dicarbonyl chloride (CAS 327-94-6) is a chemical compound with the molecular formula C8H3Cl2FO2 and a molecular weight of 221.01 g/mol. IUPAC name: 4-fluorobenzene-1,3-dicarbonyl chloride. InChIKey: FZQOFIVDXNZKTJ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2FO2 |
|---|---|
| Molecular weight | 221.01 g/mol |
| IUPAC name | 4-fluorobenzene-1,3-dicarbonyl chloride |
| InChIKey | FZQOFIVDXNZKTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)