CAS 327031-55-0 appears in our catalog under these names: Vlx-600, 95%, VLX600, VLX600/ 100%, VLX600 95%, VLX600, 95%, 95%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 10mg, 1mg, 5mg, 25mg, 50mg.
6-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (CAS 327031-55-0) is a chemical compound with the molecular formula C17H15N7 and a molecular weight of 317.3 g/mol. IUPAC name: 6-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine. InChIKey: UQOSBPRTQFFUOA-SRZZPIQSSA-N.
| Molecular formula | C17H15N7 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 6-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| InChIKey | UQOSBPRTQFFUOA-SRZZPIQSSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=C(N2)N=C(N=N3)N/N=C(\C)/C4=CC=CC=N4 |
Computed by PubChem (NCBI)