CAS 327051-69-4 is the registry number for N-(4-(Benzo[d]thiazol-2-yl)-3-hydroxyphenyl)-2,5-dichlorobenzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-2,5-dichlorobenzamide (CAS 327051-69-4) is a chemical compound with the molecular formula C20H12Cl2N2O2S and a molecular weight of 415.3 g/mol. IUPAC name: N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-2,5-dichlorobenzamide. InChIKey: QRRMRIZQZNEYLD-UHFFFAOYSA-N.
| Molecular formula | C20H12Cl2N2O2S |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-2,5-dichlorobenzamide |
| InChIKey | QRRMRIZQZNEYLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=C(C=C(C=C3)NC(=O)C4=C(C=CC(=C4)Cl)Cl)O |
Computed by PubChem (NCBI)