CAS 327056-22-4 appears in our catalog under these names: VU0285683, 97%, VU 0285683/ 99.8% (existing batch purity), VU 0285683, VU 0285683, 3-Fluoro-5-(3-(pyridin-2-yl)-1,2,4-oxadiazol-5-yl)benzonitrile, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
3-fluoro-5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzonitrile (CAS 327056-22-4) is a chemical compound with the molecular formula C14H7FN4O and a molecular weight of 266.23 g/mol. IUPAC name: 3-fluoro-5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzonitrile. InChIKey: GELAFISMURFRCA-UHFFFAOYSA-N.
| Molecular formula | C14H7FN4O |
|---|---|
| Molecular weight | 266.23 g/mol |
| IUPAC name | 3-fluoro-5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
| InChIKey | GELAFISMURFRCA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NOC(=N2)C3=CC(=CC(=C3)C#N)F |
Computed by PubChem (NCBI)