CAS 327072-95-7 appears in our catalog under these names: 2-(5-Bromo-2-ethoxybenzenesulfonamido)benzoic acid, 95%, 2-(5-Bromo-2-ethoxy-benzenesulfonylamino)-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoic acid (CAS 327072-95-7) is a chemical compound with the molecular formula C15H14BrNO5S and a molecular weight of 400.2 g/mol. IUPAC name: 2-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoic acid. InChIKey: BRJNFERKOINKQG-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO5S |
|---|---|
| Molecular weight | 400.2 g/mol |
| IUPAC name | 2-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoic acid |
| InChIKey | BRJNFERKOINKQG-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)Br)S(=O)(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)