Products 327091-18-9

CAS 327091-18-9 appears in our catalog under these names: 2,3-Dimethoxy-5-(morpholin-4-ylsulfonyl)benzoic acid, 95%, 2,3-Dimethoxy-5-(morpholine-4-sulfonyl)benzoic acid, 98%, 2,3-Dimethoxy-5-(morpholine-4-sulfonyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoic acid (CAS 327091-18-9) is a chemical compound with the molecular formula C13H17NO7S and a molecular weight of 331.34 g/mol. IUPAC name: 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoic acid. InChIKey: BGWDNGVJQSCMRY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO7S
Molecular weight331.34 g/mol
IUPAC name2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoic acid
InChIKeyBGWDNGVJQSCMRY-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)N2CCOCC2

Computed by PubChem (NCBI)