CAS 327092-95-5 is the registry number for 2-Chloro-5-hydrazinylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-chloro-5-hydrazinylbenzoic acid (CAS 327092-95-5) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-5-hydrazinylbenzoic acid. InChIKey: XZZARLOUWYGFQW-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-5-hydrazinylbenzoic acid |
| InChIKey | XZZARLOUWYGFQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(=O)O)Cl |
Computed by PubChem (NCBI)