Products 327161-03-5
CAS 327161-03-5 is the registry number for Cyclohexanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3,5-trihydroxycyclohexane-1-carboxylic acid (CAS 327161-03-5) is a chemical compound with the molecular formula C16H18O9 and a molecular weight of 354.31 g/mol. IUPAC name: 4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3,5-trihydroxycyclohexane-1-carboxylic acid. InChIKey: GYFFKZTYYAFCTR-DUXPYHPUSA-N.
| Molecular formula | C16H18O9 |
|---|---|
| Molecular weight | 354.31 g/mol |
| IUPAC name | 4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3,5-trihydroxycyclohexane-1-carboxylic acid |
| InChIKey | GYFFKZTYYAFCTR-DUXPYHPUSA-N |
| SMILES | C1C(C(C(CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)