CAS 327169-27-7 appears in our catalog under these names: [(2,1,3-Benzothiadiazol-4-ylsulfonyl)amino](phenyl)acetic acid, 95%, 2-(Benzo(c)(1,2,5)thiadiazole-4-sulfonamido)-2-phenylacetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid (CAS 327169-27-7) is a chemical compound with the molecular formula C14H11N3O4S2 and a molecular weight of 349.4 g/mol. IUPAC name: 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid. InChIKey: DIKJBLCQBZUCRC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4S2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid |
| InChIKey | DIKJBLCQBZUCRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NS(=O)(=O)C2=CC=CC3=NSN=C32 |
Computed by PubChem (NCBI)