CAS 32728-27-1 is the registry number for 4,4'-(Perfluoropropane-2,2-diyl)bis(cyanatobenzene), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate (CAS 32728-27-1) is a chemical compound with the molecular formula C17H8F6N2O2 and a molecular weight of 386.25 g/mol. IUPAC name: [4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate. InChIKey: INHGSGHLQLYYND-UHFFFAOYSA-N.
| Molecular formula | C17H8F6N2O2 |
|---|---|
| Molecular weight | 386.25 g/mol |
| IUPAC name | [4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate |
| InChIKey | INHGSGHLQLYYND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)OC#N)(C(F)(F)F)C(F)(F)F)OC#N |
Computed by PubChem (NCBI)