CAS 32742-30-6 is the registry number for 4-Methylphenyl tetra-O-acetyl-alpha-Dglucopyranoside, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylphenoxy)oxan-2-yl]methyl acetate (CAS 32742-30-6) is a chemical compound with the molecular formula C21H26O10 and a molecular weight of 438.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylphenoxy)oxan-2-yl]methyl acetate. InChIKey: OBNBHYQEYRONSE-ADAARDCZSA-N.
| Molecular formula | C21H26O10 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | OBNBHYQEYRONSE-ADAARDCZSA-N |
| SMILES | CC1=CC=C(C=C1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)