CAS 327630-34-2 is the registry number for 5-Perfluorohexyl-2,2'-bithiophene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-thiophen-2-yl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene (CAS 327630-34-2) is a chemical compound with the molecular formula C14H5F13S2 and a molecular weight of 484.3 g/mol. IUPAC name: 2-thiophen-2-yl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene. InChIKey: KILCWELZTSEPSB-UHFFFAOYSA-N.
| Molecular formula | C14H5F13S2 |
|---|---|
| Molecular weight | 484.3 g/mol |
| IUPAC name | 2-thiophen-2-yl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene |
| InChIKey | KILCWELZTSEPSB-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)