CAS 328-77-8 is the registry number for 2-(Chlorodifluoromethyl)-4,6-bis(trifluoromethyl)-1,3,5-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
2-[chloro(difluoro)methyl]-4,6-bis(trifluoromethyl)-1,3,5-triazine (CAS 328-77-8) is a chemical compound with the molecular formula C6ClF8N3 and a molecular weight of 301.52 g/mol. IUPAC name: 2-[chloro(difluoro)methyl]-4,6-bis(trifluoromethyl)-1,3,5-triazine. InChIKey: RGAZLEDDEMGAAD-UHFFFAOYSA-N.
| Molecular formula | C6ClF8N3 |
|---|---|
| Molecular weight | 301.52 g/mol |
| IUPAC name | 2-[chloro(difluoro)methyl]-4,6-bis(trifluoromethyl)-1,3,5-triazine |
| InChIKey | RGAZLEDDEMGAAD-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)C(F)(F)Cl)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)