CAS 328027-56-1 is the registry number for 4-Hydrazinyl-3-nitro-N-phenylbenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-hydrazinyl-3-nitro-N-phenylbenzenesulfonamide (CAS 328027-56-1) is a chemical compound with the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. IUPAC name: 4-hydrazinyl-3-nitro-N-phenylbenzenesulfonamide. InChIKey: SVRJRYOMDWNKCN-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O4S |
|---|---|
| Molecular weight | 308.32 g/mol |
| IUPAC name | 4-hydrazinyl-3-nitro-N-phenylbenzenesulfonamide |
| InChIKey | SVRJRYOMDWNKCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)