CAS 328028-63-3 is the registry number for 5-Amino-n-(2-chloro-phenyl)-2-morpholin-4-yl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
5-amino-N-(2-chlorophenyl)-2-morpholin-4-ylbenzenesulfonamide (CAS 328028-63-3) is a chemical compound with the molecular formula C16H18ClN3O3S and a molecular weight of 367.9 g/mol. IUPAC name: 5-amino-N-(2-chlorophenyl)-2-morpholin-4-ylbenzenesulfonamide. InChIKey: OPQBCYUORLCLHU-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3O3S |
|---|---|
| Molecular weight | 367.9 g/mol |
| IUPAC name | 5-amino-N-(2-chlorophenyl)-2-morpholin-4-ylbenzenesulfonamide |
| InChIKey | OPQBCYUORLCLHU-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)N)S(=O)(=O)NC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)