CAS 328087-15-6 is the registry number for 2-(4-Aminophenyl)-6-fluorobenzothiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(6-fluoro-1,3-benzothiazol-2-yl)aniline (CAS 328087-15-6) is a chemical compound with the molecular formula C13H9FN2S and a molecular weight of 244.29 g/mol. IUPAC name: 4-(6-fluoro-1,3-benzothiazol-2-yl)aniline. InChIKey: FIHRCVGMRDXVHA-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2S |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 4-(6-fluoro-1,3-benzothiazol-2-yl)aniline |
| InChIKey | FIHRCVGMRDXVHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=C(C=C3)F)N |
Computed by PubChem (NCBI)