CAS 32817-16-6 is the registry number for Cupricmethionline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis((2S)-2-amino-4-methylsulfanylbutanoic acid);copper (CAS 32817-16-6) is a chemical compound with the molecular formula C10H22CuN2O4S2 and a molecular weight of 362.0 g/mol. IUPAC name: bis((2S)-2-amino-4-methylsulfanylbutanoic acid);copper. InChIKey: PBRVAIFGUWYHBF-SCGRZTRASA-N.
| Molecular formula | C10H22CuN2O4S2 |
|---|---|
| Molecular weight | 362.0 g/mol |
| IUPAC name | bis((2S)-2-amino-4-methylsulfanylbutanoic acid);copper |
| InChIKey | PBRVAIFGUWYHBF-SCGRZTRASA-N |
| SMILES | CSCC[C@@H](C(=O)O)N.CSCC[C@@H](C(=O)O)N.[Cu] |
Computed by PubChem (NCBI)