CAS 328258-90-8 is the registry number for Ethacridine Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(4-ethoxyphenyl)-4-nitrobenzamide (CAS 328258-90-8) is a chemical compound with the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. IUPAC name: 2-chloro-N-(4-ethoxyphenyl)-4-nitrobenzamide. InChIKey: WKNXXIWQPIKWEA-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O4 |
|---|---|
| Molecular weight | 320.73 g/mol |
| IUPAC name | 2-chloro-N-(4-ethoxyphenyl)-4-nitrobenzamide |
| InChIKey | WKNXXIWQPIKWEA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC(=O)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)