CAS 328385-26-8 appears in our catalog under these names: 4-Desmethyl Flucarbazone Sodium Salt, 4-Desmethyl Flucarbazone Sodium Salt, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 10mg, 50mg, 1x1ml.
Sodium (3-methoxy-5-oxo-4H-1,2,4-triazole-1-carbonyl)-[2-(trifluoromethoxy)phenyl]sulfonylazanide (CAS 328385-26-8) is a chemical compound with the molecular formula C11H8F3N4NaO6S and a molecular weight of 404.26 g/mol. IUPAC name: sodium (3-methoxy-5-oxo-4H-1,2,4-triazole-1-carbonyl)-[2-(trifluoromethoxy)phenyl]sulfonylazanide. InChIKey: VMGWMAQTOMXWPA-UHFFFAOYSA-M.
| Molecular formula | C11H8F3N4NaO6S |
|---|---|
| Molecular weight | 404.26 g/mol |
| IUPAC name | sodium (3-methoxy-5-oxo-4H-1,2,4-triazole-1-carbonyl)-[2-(trifluoromethoxy)phenyl]sulfonylazanide |
| InChIKey | VMGWMAQTOMXWPA-UHFFFAOYSA-M |
| SMILES | COC1=NN(C(=O)N1)C(=O)[N-]S(=O)(=O)C2=CC=CC=C2OC(F)(F)F.[Na+] |
Computed by PubChem (NCBI)