CAS 328555-35-7 appears in our catalog under these names: 1,3-Dioxo-2-[3-(trifluoromethyl)phenyl]isoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-(3-(trifluoromethyl)phenyl)isoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylic acid (CAS 328555-35-7) is a chemical compound with the molecular formula C16H8F3NO4 and a molecular weight of 335.23 g/mol. IUPAC name: 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylic acid. InChIKey: LVGRZMPHTFMGEL-UHFFFAOYSA-N.
| Molecular formula | C16H8F3NO4 |
|---|---|
| Molecular weight | 335.23 g/mol |
| IUPAC name | 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylic acid |
| InChIKey | LVGRZMPHTFMGEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)